CAS 764717-60-4 is the registry number for 6-Methyl-1,5-naphthyridin-2-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-methyl-1H-1,5-naphthyridin-2-one (CAS 764717-60-4) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 6-methyl-1H-1,5-naphthyridin-2-one. InChIKey: VVEGURRPTDBLHJ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 6-methyl-1H-1,5-naphthyridin-2-one |
| InChIKey | VVEGURRPTDBLHJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)NC(=O)C=C2 |
Computed by PubChem (NCBI)