cas: 845655-53-0 — see every product listed under this CAS number, including other names
6-Methyl-2-oxoindoline-3-carbaldehyde 95% (CAS 845655-53-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A232041-100mg |
| cas | 845655-53-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1176.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A232041 |
6-methyl-2-oxo-1,3-dihydroindole-3-carbaldehyde (CAS 845655-53-0) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 6-methyl-2-oxo-1,3-dihydroindole-3-carbaldehyde. InChIKey: DMGZZKBQJHNTBD-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 6-methyl-2-oxo-1,3-dihydroindole-3-carbaldehyde |
| InChIKey | DMGZZKBQJHNTBD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(C(=O)N2)C=O |
Computed by PubChem (NCBI)