cas: 2963-65-7 — see every product listed under this CAS number, including other names
6-Methyl-2-phenyl-1H-benzo[d]imidazole, 95% (CAS 2963-65-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727442-100MG |
| cas | 2963-65-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 575.86 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 2382.51 Pln | |
| Fluorochem | 5g | 7589.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
6-methyl-2-phenyl-1H-benzimidazole (CAS 2963-65-7) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 6-methyl-2-phenyl-1H-benzimidazole. InChIKey: TUTVDOPAKOUNQV-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 6-methyl-2-phenyl-1H-benzimidazole |
| InChIKey | TUTVDOPAKOUNQV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)