cas: 116530-22-4 — see every product listed under this CAS number, including other names
6-Methylnaphthalen-1-amine (CAS 116530-22-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F454193-100MG |
| cas | 116530-22-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 919.49 Pln | |
| Fluorochem | 250mg | 1627.57 Pln | |
| Fluorochem | 1g | 3184.31 Pln | |
| Fluorochem | 5g | 11379.34 Pln |
| delivery time | 3-4 weeks |
|---|
6-methylnaphthalen-1-amine (CAS 116530-22-4) is a chemical compound with the molecular formula C11H11N and a molecular weight of 157.21 g/mol. IUPAC name: 6-methylnaphthalen-1-amine. InChIKey: JHQJTDIFWIZURA-UHFFFAOYSA-N.
| Molecular formula | C11H11N |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | 6-methylnaphthalen-1-amine |
| InChIKey | JHQJTDIFWIZURA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CC=C2)N |
Computed by PubChem (NCBI)