6-Methylpyridine-2-sulfonyl chloride, 95%
cas: 281221-71-4 — see every product listed under this CAS number, including other names
6-Methylpyridine-2-sulfonyl chloride, 95% (CAS 281221-71-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A694810-100mg |
| cas | 281221-71-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1265.94 Pln | |
| Ambeed | 250mg | 3051.50 Pln | |
| Ambeed | 1g | 8947.75 Pln | |
| Chemat | 100mg | 846.80 Pln | |
| BLDpharm | 50mg | 858.61 Pln | |
| BLDpharm | 100mg | 1358.44 Pln | |
| BLDpharm | 250mg | 3279.98 Pln | |
| BLDpharm | 1g | 8778.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-methylpyridine-2-sulfonyl chloride (CAS 281221-71-4) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 6-methylpyridine-2-sulfonyl chloride. InChIKey: YUWSYDYNEKIQLL-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 6-methylpyridine-2-sulfonyl chloride |
| InChIKey | YUWSYDYNEKIQLL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)