cas: 6325-91-3 — see every product listed under this CAS number, including other names
6-Nitro-1H-benzoimidazole-2-thiol, 97% (CAS 6325-91-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F344515-1G |
| cas | 6325-91-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 825.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
5-nitro-1,3-dihydrobenzimidazole-2-thione (CAS 6325-91-3) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 5-nitro-1,3-dihydrobenzimidazole-2-thione. InChIKey: YPXQSGWOGQPLQO-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-nitro-1,3-dihydrobenzimidazole-2-thione |
| InChIKey | YPXQSGWOGQPLQO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=S)N2 |
Computed by PubChem (NCBI)