6-Nitro-1H-indole-3-sulfonyl chloride, 95%
cas: 132745-00-7 — see every product listed under this CAS number, including other names
6-Nitro-1H-indole-3-sulfonyl chloride, 95% (CAS 132745-00-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1130126-250mg |
| cas | 132745-00-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 1176.94 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 285.20 Pln | |
| BLDpharm | 250mg | 208.84 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 1264.02 Pln | |
| Fluorochem | 1g | 310.32 Pln | |
| Fluorochem | 5g | 1216.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
6-nitro-1H-indole-3-sulfonyl chloride (CAS 132745-00-7) is a chemical compound with the molecular formula C8H5ClN2O4S and a molecular weight of 260.65 g/mol. IUPAC name: 6-nitro-1H-indole-3-sulfonyl chloride. InChIKey: NKYPYESQRSNEOB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4S |
|---|---|
| Molecular weight | 260.65 g/mol |
| IUPAC name | 6-nitro-1H-indole-3-sulfonyl chloride |
| InChIKey | NKYPYESQRSNEOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)