CAS 952-10-3 appears in our catalog under these names: 2,3-Dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl chloride 98%, 2-hydroxy-3-oxo-3,4-dihydroquinoxaline-6-sulfonyl chloride, 97%, 2,3-Dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl chloride, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g.
2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonyl chloride (CAS 952-10-3) is a chemical compound with the molecular formula C8H5ClN2O4S and a molecular weight of 260.65 g/mol. IUPAC name: 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonyl chloride. InChIKey: VJHXFHCNOUEKQY-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4S |
|---|---|
| Molecular weight | 260.65 g/mol |
| IUPAC name | 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonyl chloride |
| InChIKey | VJHXFHCNOUEKQY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)Cl)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)