CAS 132745-00-7 appears in our catalog under these names: 6-Nitro-1H-indole-3-sulfonyl chloride, 6-Nitro-1H-indole-3-sulfonyl chloride 95%, 6-nitro-1H-indole-3-sulfonyl chloride, 95%, 95%, 6-Nitro-1h-indole-3-sulfonyl chloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g.
6-nitro-1H-indole-3-sulfonyl chloride (CAS 132745-00-7) is a chemical compound with the molecular formula C8H5ClN2O4S and a molecular weight of 260.65 g/mol. IUPAC name: 6-nitro-1H-indole-3-sulfonyl chloride. InChIKey: NKYPYESQRSNEOB-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4S |
|---|---|
| Molecular weight | 260.65 g/mol |
| IUPAC name | 6-nitro-1H-indole-3-sulfonyl chloride |
| InChIKey | NKYPYESQRSNEOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)