CAS 3861-99-2 is the registry number for 4-Chloro-5-sulfamoylphthalimide. Offered by: TRC. Available pack sizes: 100mg, 1g, 250mg.
6-chloro-1,3-dioxoisoindole-5-sulfonamide (CAS 3861-99-2) is a chemical compound with the molecular formula C8H5ClN2O4S and a molecular weight of 260.65 g/mol. IUPAC name: 6-chloro-1,3-dioxoisoindole-5-sulfonamide. InChIKey: BSWMHSXPIVWLJR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O4S |
|---|---|
| Molecular weight | 260.65 g/mol |
| IUPAC name | 6-chloro-1,3-dioxoisoindole-5-sulfonamide |
| InChIKey | BSWMHSXPIVWLJR-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1S(=O)(=O)N)Cl)C(=O)NC2=O |
Computed by PubChem (NCBI)