cas: 6285-57-0 — see every product listed under this CAS number, including other names
6-Nitrobenzo[d]thiazol-2-amine, 98%, 98% (CAS 6285-57-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NBC-250mg |
| cas | 6285-57-0 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 261.20 Pln | |
| Chemat | 25g | 462.80 Pln | |
| Chemat | 100g | 1307.60 Pln | |
| Chemat | 500g | 4617.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-nitro-1,3-benzothiazol-2-amine (CAS 6285-57-0) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 6-nitro-1,3-benzothiazol-2-amine. InChIKey: GPNAVOJCQIEKQF-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 6-nitro-1,3-benzothiazol-2-amine |
| InChIKey | GPNAVOJCQIEKQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC(=N2)N |
Computed by PubChem (NCBI)