cas: 64495-55-2 — see every product listed under this CAS number, including other names
6-Nitroquinolin-2(1H)-one, 97% (CAS 64495-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221039-100MG |
| cas | 64495-55-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 872.63 Pln | |
| Fluorochem | 10g | 1684.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-nitro-1H-quinolin-2-one (CAS 64495-55-2) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 6-nitro-1H-quinolin-2-one. InChIKey: OYLJUJGLDPDXHP-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 6-nitro-1H-quinolin-2-one |
| InChIKey | OYLJUJGLDPDXHP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)N2)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)