cas: 16727-28-9 — see every product listed under this CAS number, including other names
6-Nitroquinolin-8-ol, 95%, 95% (CAS 16727-28-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AB8Y-100mg |
| cas | 16727-28-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 395.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-nitroquinolin-8-ol (CAS 16727-28-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 6-nitroquinolin-8-ol. InChIKey: BVBQGQLGXJDKLZ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 6-nitroquinolin-8-ol |
| InChIKey | BVBQGQLGXJDKLZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)