6-Oxa-2-azaspiro[3.4]octane oxalate, 98%
cas: 1392804-58-8 — see every product listed under this CAS number, including other names
6-Oxa-2-azaspiro[3.4]octane oxalate, 98% (CAS 1392804-58-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A306287-250mg |
| cas | 1392804-58-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 392.62 Pln | |
| Ambeed | 1g | 965.56 Pln | |
| Chemat | 250mg | 1206.80 Pln | |
| Chemat | 1g | 2920.40 Pln | |
| BLDpharm | 100mg | 236.61 Pln | |
| BLDpharm | 250mg | 419.88 Pln | |
| BLDpharm | 1g | 1036.33 Pln | |
| Fluorochem | 250mg | 2236.73 Pln | |
| Fluorochem | 1g | 5412.70 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
6-oxa-2-azaspiro[3.4]octane;oxalic acid (CAS 1392804-58-8) is a chemical compound with the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. IUPAC name: 6-oxa-2-azaspiro[3.4]octane;oxalic acid. InChIKey: ZYLBDQDHPKYAOH-UHFFFAOYSA-N.
| Molecular formula | C8H13NO5 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 6-oxa-2-azaspiro[3.4]octane;oxalic acid |
| InChIKey | ZYLBDQDHPKYAOH-UHFFFAOYSA-N |
| SMILES | C1COCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)