cas: 406463-06-7 — see every product listed under this CAS number, including other names
6-Quinolineboronic Acid Pinacol Ester, 98%, 98% (CAS 406463-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11870S-250mg |
| cas | 406463-06-7 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 25g | 822.80 Pln | |
| Chemat | 10g | 366.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 406463-06-7) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: VMFALDWCEQUFSX-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | VMFALDWCEQUFSX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)