cas: 99071-54-2 — see every product listed under this CAS number, including other names
6-quinolinemethanamine, 95%, 95% (CAS 99071-54-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145BN-100mg |
| cas | 99071-54-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 1173.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Quinolin-6-ylmethanamine (CAS 99071-54-2) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: quinolin-6-ylmethanamine. InChIKey: RZIPENSSTUBRAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | quinolin-6-ylmethanamine |
| InChIKey | RZIPENSSTUBRAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CN)N=C1 |
Computed by PubChem (NCBI)