CAS 99071-54-2 appears in our catalog under these names: 6-Aminomethylquinoline, 96%, 6-Aminomethylquinoline 95%, 6-quinolinemethanamine, 95%, 95%, C-Quinolin-6-yl-methylamine, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
Quinolin-6-ylmethanamine (CAS 99071-54-2) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: quinolin-6-ylmethanamine. InChIKey: RZIPENSSTUBRAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | quinolin-6-ylmethanamine |
| InChIKey | RZIPENSSTUBRAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CN)N=C1 |
Computed by PubChem (NCBI)