cas: 823787-25-3 — see every product listed under this CAS number, including other names
7-(2-Bromophenyl)-1,4-dioxaspiro(4.5)decan-8-one, 95-<97% (CAS 823787-25-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5555-95-97-1g |
| cas | 823787-25-3 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 4123.24 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6987.86 Pln | |
| Hoffman Fine Chemicals | 5g | 10988.12 Pln | |
| Hoffman Fine Chemicals | 10g | 17400.02 Pln | |
| Hoffman Fine Chemicals | 25g | 36629.34 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
7-(2-bromophenyl)-1,4-dioxaspiro[4.5]decan-8-one (CAS 823787-25-3) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: 7-(2-bromophenyl)-1,4-dioxaspiro[4.5]decan-8-one. InChIKey: BIPGDPGUCRSESK-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | 7-(2-bromophenyl)-1,4-dioxaspiro[4.5]decan-8-one |
| InChIKey | BIPGDPGUCRSESK-UHFFFAOYSA-N |
| SMILES | C1CC2(CC(C1=O)C3=CC=CC=C3Br)OCCO2 |
Computed by PubChem (NCBI)