Products 2763159-22-2
CAS 2763159-22-2 is the registry number for 7-Bromo-1-oxo-2,3-dihydro-1H-inden-5-yl pivalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-bromo-1-oxo-2,3-dihydroinden-5-yl) 2,2-dimethylpropanoate (CAS 2763159-22-2) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: (7-bromo-1-oxo-2,3-dihydroinden-5-yl) 2,2-dimethylpropanoate. InChIKey: UDAYBYYRLWFHNK-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | (7-bromo-1-oxo-2,3-dihydroinden-5-yl) 2,2-dimethylpropanoate |
| InChIKey | UDAYBYYRLWFHNK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC2=C(C(=O)CC2)C(=C1)Br |
Computed by PubChem (NCBI)