CAS 212757-09-0 appears in our catalog under these names: trans-2-(4-Bromobenzoyl)cyclohexanecarboxylic acid, 98%, trans-2-(4-Bromobenzoyl)-1-cyclohexanecarboxylic acid, 98%, Cyclohexanecarboxylicacid, 2-(4-bromobenzoyl)-, (1R,2R)-rel-, 98%, 98%, rel-(1R,2R)-2-(4-Bromobenzoyl)cyclohexane-1-carboxylic acid, 98%. Offered by: AmBeed, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
Trans-(1R,2R)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid (CAS 212757-09-0) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: trans-(1R,2R)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid. InChIKey: OVZXXISOLDHARA-VXGBXAGGSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid |
| InChIKey | OVZXXISOLDHARA-VXGBXAGGSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)