Products 2305050-56-8
CAS 2305050-56-8 is the registry number for (1S,2S)-2-(4-Bromobenzoyl)cyclohexane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid (CAS 2305050-56-8) is a chemical compound with the molecular formula C14H15BrO3 and a molecular weight of 311.17 g/mol. IUPAC name: trans-(1S,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid. InChIKey: OVZXXISOLDHARA-RYUDHWBXSA-N.
| Molecular formula | C14H15BrO3 |
|---|---|
| Molecular weight | 311.17 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylic acid |
| InChIKey | OVZXXISOLDHARA-RYUDHWBXSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)