cas: 1361110-64-6 — see every product listed under this CAS number, including other names
7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-benzo[b][1,4]oxazine, 95% (CAS 1361110-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322865-100MG |
| cas | 1361110-64-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 846.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (CAS 1361110-64-6) is a chemical compound with the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine. InChIKey: AUGHRUKXHXNOCW-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO3 |
|---|---|
| Molecular weight | 261.13 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| InChIKey | AUGHRUKXHXNOCW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NCCO3 |
Computed by PubChem (NCBI)