cas: 120004-79-7 — see every product listed under this CAS number, including other names
7-(4-chlorobutoxy)-3,4-dihydro-1H-quinolin-2-one (CAS 120004-79-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609026-100MG |
| cas | 120004-79-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1070.47 Pln | |
| Fluorochem | 5g | 3913.22 Pln |
| delivery time | 3-4 weeks |
|---|
7-(4-chlorobutoxy)-3,4-dihydro-1H-quinolin-2-one (CAS 120004-79-7) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: 7-(4-chlorobutoxy)-3,4-dihydro-1H-quinolin-2-one. InChIKey: SRMLSNBGMDJSJH-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | 7-(4-chlorobutoxy)-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | SRMLSNBGMDJSJH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2)OCCCCCl |
Computed by PubChem (NCBI)