Products 876715-85-4

CAS 876715-85-4 appears in our catalog under these names: 1-(2-Chlorobenzyl)piperidine-4-carboxylic acid, 95%, 1-(2-Chlorobenzyl)piperidine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

1-[(2-chlorophenyl)methyl]piperidine-4-carboxylic acid (CAS 876715-85-4) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]piperidine-4-carboxylic acid. InChIKey: IWGYNCJBXZCOMM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO2
Molecular weight253.72 g/mol
IUPAC name1-[(2-chlorophenyl)methyl]piperidine-4-carboxylic acid
InChIKeyIWGYNCJBXZCOMM-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)CC2=CC=CC=C2Cl

Computed by PubChem (NCBI)