CAS 339015-92-8 is the registry number for N-(4-Acetylphenyl)-3-chloro-2,2-dimethylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-(4-acetylphenyl)-3-chloro-2,2-dimethylpropanamide (CAS 339015-92-8) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: N-(4-acetylphenyl)-3-chloro-2,2-dimethylpropanamide. InChIKey: RFWDCYIKIBSEAP-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | N-(4-acetylphenyl)-3-chloro-2,2-dimethylpropanamide |
| InChIKey | RFWDCYIKIBSEAP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C(C)(C)CCl |
Computed by PubChem (NCBI)