CAS 105842-89-5 appears in our catalog under these names: N-(2-[4-(2-Chloropropanoyl)phenyl]ethyl)acetamide, 95%, N-{2-(4-(2-Chloropropanoyl)phenyl)ethyl}acetamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
N-[2-[4-(2-chloropropanoyl)phenyl]ethyl]acetamide (CAS 105842-89-5) is a chemical compound with the molecular formula C13H16ClNO2 and a molecular weight of 253.72 g/mol. IUPAC name: N-[2-[4-(2-chloropropanoyl)phenyl]ethyl]acetamide. InChIKey: KVZIMDNIVVWTAC-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO2 |
|---|---|
| Molecular weight | 253.72 g/mol |
| IUPAC name | N-[2-[4-(2-chloropropanoyl)phenyl]ethyl]acetamide |
| InChIKey | KVZIMDNIVVWTAC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)CCNC(=O)C)Cl |
Computed by PubChem (NCBI)