cas: 1630906-56-7 — see every product listed under this CAS number, including other names
7-(BENZENESULFONYL)-N-METHYL-7H-PYRROLO[2,3-D]PYRIMIDIN-4-AMINE, 97% (CAS 1630906-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504640-250MG |
| cas | 1630906-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 500mg | 325.94 Pln | |
| Fluorochem | 1g | 456.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 1630906-56-7) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: LEVSJQBXAGKDIP-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | LEVSJQBXAGKDIP-UHFFFAOYSA-N |
| SMILES | CNC1=C2C=CN(C2=NC=N1)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)