cas: 1630906-56-7 — see every product listed under this CAS number, including other names
N-Methyl-7-(phenylsulfonyl)-7H-pyrrolo(2,3-d)pyrimidin-4-amine, 97% (CAS 1630906-56-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A791349-10g |
| cas | 1630906-56-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4125.73 Pln | |
| AmBeed | 25g | 5056.66 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine (CAS 1630906-56-7) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: LEVSJQBXAGKDIP-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-N-methylpyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | LEVSJQBXAGKDIP-UHFFFAOYSA-N |
| SMILES | CNC1=C2C=CN(C2=NC=N1)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)