cas: 118116-71-5 — see every product listed under this CAS number, including other names
7-(Diethylamino)-3-nitro-2h-chromen-2-one, 95%, 95% (CAS 118116-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1107UI-100mg |
| cas | 118116-71-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-(diethylamino)-3-nitrochromen-2-one (CAS 118116-71-5) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: 7-(diethylamino)-3-nitrochromen-2-one. InChIKey: PYMZNADOZXKAMB-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 7-(diethylamino)-3-nitrochromen-2-one |
| InChIKey | PYMZNADOZXKAMB-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)