cas: 16499-58-4 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)quinazolin-4(3H)-one, 98%, 98% (CAS 16499-58-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQK7-100mg |
| cas | 16499-58-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1283.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-(trifluoromethyl)-3H-quinazolin-4-one (CAS 16499-58-4) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 7-(trifluoromethyl)-3H-quinazolin-4-one. InChIKey: PPQZFZZPLINSJL-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3H-quinazolin-4-one |
| InChIKey | PPQZFZZPLINSJL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=CNC2=O |
Computed by PubChem (NCBI)