cas: 197080-73-2 — see every product listed under this CAS number, including other names
7-(tert-Butyl) 2-methyl rel-(1R,2R,4S)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate 97% (CAS 197080-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A670286-100mg |
| cas | 197080-73-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2061.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A670286 |
7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CAS 197080-73-2) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate. InChIKey: ZBESKVIRYNQXCD-UTLUCORTSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| InChIKey | ZBESKVIRYNQXCD-UTLUCORTSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1[C@H](C2)C(=O)OC |
Computed by PubChem (NCBI)