cas: 197080-73-2 — see every product listed under this CAS number, including other names
ENDO-7-TERT-BUTYL 2-METHYL 7-AZABICYCLO[2.2.1]HEPTANE-2,7-DICARBOXYLATE, 95%, 95% (CAS 197080-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DUDX-100mg |
| cas | 197080-73-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1571.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate (CAS 197080-73-2) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate. InChIKey: ZBESKVIRYNQXCD-UTLUCORTSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-methyl (1S,2S,4R)-7-azabicyclo[2.2.1]heptane-2,7-dicarboxylate |
| InChIKey | ZBESKVIRYNQXCD-UTLUCORTSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1[C@H](C2)C(=O)OC |
Computed by PubChem (NCBI)