cas: 105807-83-8 — see every product listed under this CAS number, including other names
7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one 98% (CAS 105807-83-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167186-250mg |
| cas | 105807-83-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 25g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167186 |
7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 105807-83-8) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: UXMAGPQBCODAEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | UXMAGPQBCODAEJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=C(C=C2)N)C |
Computed by PubChem (NCBI)