CAS 1305325-10-3 is the registry number for 2-(tert-Butyl)oxazolo[4,5-c]pyridin-7-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-ol (CAS 1305325-10-3) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-ol. InChIKey: WHRWLBNMDGQNEZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-ol |
| InChIKey | WHRWLBNMDGQNEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=CN=CC(=C2O1)O |
Computed by PubChem (NCBI)