Products 105807-83-8
CAS 105807-83-8 appears in our catalog under these names: 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%, 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one 98%, 7-Amino-2，2-dimethyl-2H-benzo[b][1，4]oxazin-3(4H)-one, 97%, 97%, 7-Amino-2,2-dimethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.
7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one (CAS 105807-83-8) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one. InChIKey: UXMAGPQBCODAEJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 7-amino-2,2-dimethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | UXMAGPQBCODAEJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=C(C=C2)N)C |
Computed by PubChem (NCBI)