CAS 30779-70-5 appears in our catalog under these names: 7-Amino-2-methylchromone, 95%, 7-AMINO-2-METHYLCHROMONE 95, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
7-amino-2-methylchromen-4-one (CAS 30779-70-5) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 7-amino-2-methylchromen-4-one. InChIKey: PAKDFQZWVPNDSC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 7-amino-2-methylchromen-4-one |
| InChIKey | PAKDFQZWVPNDSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(O1)C=C(C=C2)N |
Computed by PubChem (NCBI)