CAS 79349-82-9 appears in our catalog under these names: 7-Amino-3-vinyl-3-cephem-4-carboxylic acid, 95%, Cefdinir Impurity C, Cefixime Impurity (7-AVCA), 7-Amino-3-vinyl-3-cephem-4-carboxylic Acid, (6R,7R)-7-Amino-8-oxo-3-vinyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, on request, 100mg, 10mg.
(6R,7R)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 79349-82-9) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: (6R,7R)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: GQLGFBRMCCVQLU-SVGQVSJJSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | (6R,7R)-7-amino-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | GQLGFBRMCCVQLU-SVGQVSJJSA-N |
| SMILES | C=CC1=C(N2[C@@H]([C@@H](C2=O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)