CAS 7677-49-8 is the registry number for 2-[(1,1-Dioxido-1,2-benzisothiazol-3-yl)amino]ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanol (CAS 7677-49-8) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanol. InChIKey: DYWHFCILLXJTMM-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethanol |
| InChIKey | DYWHFCILLXJTMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NCCO)NS2(=O)=O |
Computed by PubChem (NCBI)