CAS 337488-30-9 is the registry number for 1-Cyclopropyl-2-[(4,6-dihydroxypyrimidin-2-yl)thio]ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2-cyclopropyl-2-oxoethyl)sulfanyl-4-hydroxy-1H-pyrimidin-6-one (CAS 337488-30-9) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 2-(2-cyclopropyl-2-oxoethyl)sulfanyl-4-hydroxy-1H-pyrimidin-6-one. InChIKey: DZNZGIVDYHUEMK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 2-(2-cyclopropyl-2-oxoethyl)sulfanyl-4-hydroxy-1H-pyrimidin-6-one |
| InChIKey | DZNZGIVDYHUEMK-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)CSC2=NC(=CC(=O)N2)O |
Computed by PubChem (NCBI)