CAS 68292-02-4 appears in our catalog under these names: N-Methyl Zonisamide, N-Methyl Zonisamide, >95% (HPLC), 1-(Benzo[d]isoxazol-3-yl)-N-methylmethanesulfonamide 98%, 1-(Benzo[d]isoxazol-3-yl)-N-methylmethanesulfonamide, 98%, 98%. Offered by: Chemat Brand, TRC, Ambeed, Chemat. Available pack sizes: on request, 250mg, 25mg, 100mg, 1g.
1-(1,2-benzoxazol-3-yl)-N-methylmethanesulfonamide (CAS 68292-02-4) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 1-(1,2-benzoxazol-3-yl)-N-methylmethanesulfonamide. InChIKey: IFLCNEUQVNHBJU-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 1-(1,2-benzoxazol-3-yl)-N-methylmethanesulfonamide |
| InChIKey | IFLCNEUQVNHBJU-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)CC1=NOC2=CC=CC=C21 |
Computed by PubChem (NCBI)