CAS 1269397-43-4 appears in our catalog under these names: 7-Amino-4-ethyl-2h-1,4-benzoxazin-3(4h)-one hydrochloride, 95%, 7-Amino-4-ethyl-2H-benzo[b][1,4]oxazin-3(4H)-one hydrochloride, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
7-amino-4-ethyl-1,4-benzoxazin-3-one;hydrochloride (CAS 1269397-43-4) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 7-amino-4-ethyl-1,4-benzoxazin-3-one;hydrochloride. InChIKey: RJTQTJJQRALUHM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 7-amino-4-ethyl-1,4-benzoxazin-3-one;hydrochloride |
| InChIKey | RJTQTJJQRALUHM-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)COC2=C1C=CC(=C2)N.Cl |
Computed by PubChem (NCBI)