CAS 1909313-13-8 is the registry number for 2-(cyclobutylamino)pyridine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride (CAS 1909313-13-8) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride. InChIKey: QFWNZNRMOGPYAG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride |
| InChIKey | QFWNZNRMOGPYAG-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NC2=NC=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)