Products 1909313-13-8

CAS 1909313-13-8 is the registry number for 2-(cyclobutylamino)pyridine-4-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride (CAS 1909313-13-8) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride. InChIKey: QFWNZNRMOGPYAG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClN2O2
Molecular weight228.67 g/mol
IUPAC name2-(cyclobutylamino)pyridine-4-carboxylic acid;hydrochloride
InChIKeyQFWNZNRMOGPYAG-UHFFFAOYSA-N
SMILESC1CC(C1)NC2=NC=CC(=C2)C(=O)O.Cl

Computed by PubChem (NCBI)