CAS 1021339-26-3 is the registry number for N-(2-Chloro-3-hydroxypyridin-4-yl)pivalamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
N-(2-chloro-3-hydroxy-4-pyridinyl)-2,2-dimethylpropanamide (CAS 1021339-26-3) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: N-(2-chloro-3-hydroxy-4-pyridinyl)-2,2-dimethylpropanamide. InChIKey: DDZBDCPTLSFIME-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | N-(2-chloro-3-hydroxy-4-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | DDZBDCPTLSFIME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C(=NC=C1)Cl)O |
Computed by PubChem (NCBI)