CAS 1177334-30-3 appears in our catalog under these names: 5-Aminomethyl-3-phenyl-oxazolidin-2-one hydrochloride, 95%, 5-(Aminomethyl)-3-phenyl-1,3-oxazolidin-2-one hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
5-(aminomethyl)-3-phenyl-1,3-oxazolidin-2-one;hydrochloride (CAS 1177334-30-3) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 5-(aminomethyl)-3-phenyl-1,3-oxazolidin-2-one;hydrochloride. InChIKey: ZNDXECFYUAOJNS-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 5-(aminomethyl)-3-phenyl-1,3-oxazolidin-2-one;hydrochloride |
| InChIKey | ZNDXECFYUAOJNS-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)