cas: 945381-62-4 — see every product listed under this CAS number, including other names
7-Amino-5-fluoroindolin-2-one 95% (CAS 945381-62-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184594-250mg |
| cas | 945381-62-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A184594 |
7-amino-5-fluoro-1,3-dihydroindol-2-one (CAS 945381-62-4) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 7-amino-5-fluoro-1,3-dihydroindol-2-one. InChIKey: DIFFVSPISVQLKF-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 7-amino-5-fluoro-1,3-dihydroindol-2-one |
| InChIKey | DIFFVSPISVQLKF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)N)NC1=O |
Computed by PubChem (NCBI)