cas: 945381-62-4 — see every product listed under this CAS number, including other names
7-Amino-5-fluoroindolin-2-one, 95%, 95% (CAS 945381-62-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H71I-100mg |
| cas | 945381-62-4 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 328.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-amino-5-fluoro-1,3-dihydroindol-2-one (CAS 945381-62-4) is a chemical compound with the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. IUPAC name: 7-amino-5-fluoro-1,3-dihydroindol-2-one. InChIKey: DIFFVSPISVQLKF-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2O |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 7-amino-5-fluoro-1,3-dihydroindol-2-one |
| InChIKey | DIFFVSPISVQLKF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)N)NC1=O |
Computed by PubChem (NCBI)