cas: 1261810-14-3 — see every product listed under this CAS number, including other names
7-Aminoquinolin-3-ol, 95+% (CAS 1261810-14-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A215311-5g |
| cas | 1261810-14-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22138.90 Pln | |
| AmBeed | 1g | 6801.34 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-aminoquinolin-3-ol (CAS 1261810-14-3) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 7-aminoquinolin-3-ol. InChIKey: FBCYEUNEXNNAEM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 7-aminoquinolin-3-ol |
| InChIKey | FBCYEUNEXNNAEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)O)N |
Computed by PubChem (NCBI)