cas: 56881-31-3 — see every product listed under this CAS number, including other names
7-Aminothieno[2,3-b]pyrazine-6-carboxylic acid, 90% (CAS 56881-31-3) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO07475CB |
| cas | 56881-31-3 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 285.59 Pln | |
| Thermo Scientific | 1g | 733.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
7-aminothieno[2,3-b]pyrazine-6-carboxylic acid (CAS 56881-31-3) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 7-aminothieno[2,3-b]pyrazine-6-carboxylic acid. InChIKey: UJUCBOIXAMPUQL-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 7-aminothieno[2,3-b]pyrazine-6-carboxylic acid |
| InChIKey | UJUCBOIXAMPUQL-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=C(S2)C(=O)O)N |
Computed by PubChem (NCBI)