cas: 865472-04-4 — see every product listed under this CAS number, including other names
7-BROMO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-AMINE, 97% (CAS 865472-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467018-100MG |
| cas | 865472-04-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2080.54 Pln | |
| Fluorochem | 10g | 3507.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 865472-04-4) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: PHUSWQSCHYYQQF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | PHUSWQSCHYYQQF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)