cas: 865472-04-4 — see every product listed under this CAS number, including other names
7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine, 98%, 98% (CAS 865472-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115V4X-100mg |
| cas | 865472-04-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1504.40 Pln | |
| Chemat | 10g | 2786.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 865472-04-4) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: 7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: PHUSWQSCHYYQQF-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | 7-bromo-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | PHUSWQSCHYYQQF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)